C21H21IN2O5S2 — CID 98192480
N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 98192480) has the molecular formula C21H21IN2O5S2 and a molecular weight of 572.45 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98192480 |
| Molecular Formula | C21H21IN2O5S2 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@H]3CS(=O)(=O)C[C@@H]3N2c2cccc(I)c2)cc1OC |
| InChI | InChI=1S/C21H21IN2O5S2/c1-28-17-7-6-13(8-18(17)29-2)9-20(25)23-21-24(15-5-3-4-14(22)10-15)16-11-31(26,27)12-19(16)30-21/h3-8,10,16,19H,9,11-12H2,1-2H3/b23-21-/t16-,19-/m0/s1 |
| InChIKey | AOBJXGCHIPEGOT-PNLCSIRQSA-N |
| XLogP | 3.15 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|