C19H16ClIN2O3S2 — CID 98192442
N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide (PubChem CID 98192442) has the molecular formula C19H16ClIN2O3S2 and a molecular weight of 546.84 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 98192442 |
| Molecular Formula | C19H16ClIN2O3S2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 545.93 |
| IUPAC Name | N-[(3aS,6aR)-3-(3-iodophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1cccc(I)c1 |
| InChI | InChI=1S/C19H16ClIN2O3S2/c20-13-6-4-12(5-7-13)8-18(24)22-19-23(15-3-1-2-14(21)9-15)16-10-28(25,26)11-17(16)27-19/h1-7,9,16-17H,8,10-11H2/b22-19-/t16-,17-/m0/s1 |
| InChIKey | LOFLJSOFVXERIH-RKRZTECPSA-N |
| XLogP | 3.79 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|