C16H17N3O5S2 — CID 4870684
2-cyano-N-[3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide (PubChem CID 4870684) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-cyano-N-[3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide.
| Compound Name | 2-cyano-N-[3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 4870684 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-cyano-N-[3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
| SMILES | COc1ccc(OC)c(N2/C(=N/C(=O)CC#N)SC3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C16H17N3O5S2/c1-23-10-3-4-13(24-2)11(7-10)19-12-8-26(21,22)9-14(12)25-16(19)18-15(20)5-6-17/h3-4,7,12,14H,5,8-9H2,1-2H3/b18-16- |
| InChIKey | HTPCSSOBMROOSE-VLGSPTGOSA-N |
| XLogP | 1.22 |
| TPSA | 109.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|