C21H28N2O5S2 — CID 39737023
N-[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide (PubChem CID 39737023) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide.
| Compound Name | N-[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 39737023 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
| SMILES | COc1ccc(OC)c(N2/C(=N/C(=O)CCC3CCCC3)S[C@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-27-15-8-9-18(28-2)16(11-15)23-17-12-30(25,26)13-19(17)29-21(23)22-20(24)10-7-14-5-3-4-6-14/h8-9,11,14,17,19H,3-7,10,12-13H2,1-2H3/b22-21-/t17-,19-/m0/s1 |
| InChIKey | CTRGCIUCGGEQNN-IBSNTXEOSA-N |
| XLogP | 3.28 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|