C21H27ClN2O5S2 — CID 39738918
N-[(3aS,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide (PubChem CID 39738918) has the molecular formula C21H27ClN2O5S2 and a molecular weight of 487.04 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide.
| Compound Name | N-[(3aS,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 39738918 |
| Molecular Formula | C21H27ClN2O5S2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[(3aS,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
| SMILES | COc1cc(OC)c(N2/C(=N/C(=O)CCC3CCCC3)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1Cl |
| InChI | InChI=1S/C21H27ClN2O5S2/c1-28-17-10-18(29-2)15(9-14(17)22)24-16-11-31(26,27)12-19(16)30-21(24)23-20(25)8-7-13-5-3-4-6-13/h9-10,13,16,19H,3-8,11-12H2,1-2H3/b23-21-/t16-,19+/m0/s1 |
| InChIKey | YYZAYUMDUOGEAX-SEABKWOMSA-N |
| XLogP | 3.93 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|