C17H19ClN2O8S2 — CID 39738906
2-[2-[[(3aR,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid (PubChem CID 39738906) has the molecular formula C17H19ClN2O8S2 and a molecular weight of 478.93 g/mol. Its IUPAC name is 2-[2-[[(3aR,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3aR,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 39738906 |
| Molecular Formula | C17H19ClN2O8S2 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2-[2-[[(3aR,6aS)-3-(5-chloro-2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
| SMILES | COc1cc(OC)c(N2/C(=N/C(=O)COCC(=O)O)S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O8S2/c1-26-12-4-13(27-2)10(3-9(12)18)20-11-7-30(24,25)8-14(11)29-17(20)19-15(21)5-28-6-16(22)23/h3-4,11,14H,5-8H2,1-2H3,(H,22,23)/b19-17-/t11-,14-/m1/s1 |
| InChIKey | VXGWGSAQWATYDS-QAYGOSDWSA-N |
| XLogP | 1.06 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|