C15H14BrClN2O6S2 — CID 39882612
2-[2-[[(3aR,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid (PubChem CID 39882612) has the molecular formula C15H14BrClN2O6S2 and a molecular weight of 497.78 g/mol. Its IUPAC name is 2-[2-[[(3aR,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3aR,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 39882612 |
| Molecular Formula | C15H14BrClN2O6S2 |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 495.92 |
| IUPAC Name | 2-[2-[[(3aR,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H14BrClN2O6S2/c16-8-1-2-10(9(17)3-8)19-11-6-27(23,24)7-12(11)26-15(19)18-13(20)4-25-5-14(21)22/h1-3,11-12H,4-7H2,(H,21,22)/b18-15-/t11-,12+/m1/s1 |
| InChIKey | DKWNYUZLGBHVKU-ZJVHTTKQSA-N |
| XLogP | 1.81 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|