C20H18BrClN2O4S2 — CID 98192201
N-[(3aS,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide (PubChem CID 98192201) has the molecular formula C20H18BrClN2O4S2 and a molecular weight of 529.87 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98192201 |
| Molecular Formula | C20H18BrClN2O4S2 |
| Molecular Weight | 529.87 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | N-[(3aS,6aR)-3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C20H18BrClN2O4S2/c1-28-17-5-3-2-4-12(17)8-19(25)23-20-24(15-7-6-13(21)9-14(15)22)16-10-30(26,27)11-18(16)29-20/h2-7,9,16,18H,8,10-11H2,1H3/b23-20-/t16-,18-/m0/s1 |
| InChIKey | YSSDBXXTCDDXFF-DHFOVVOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|