C21H18ClF3N2O4S2 — CID 43838301
N-[3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide (PubChem CID 43838301) has the molecular formula C21H18ClF3N2O4S2 and a molecular weight of 518.97 g/mol. Its IUPAC name is N-[3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43838301 |
| Molecular Formula | C21H18ClF3N2O4S2 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | N-[3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)/N=C1\SC2CS(=O)(=O)CC2N1c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H18ClF3N2O4S2/c1-31-17-5-3-2-4-12(17)8-19(28)26-20-27(16-10-33(29,30)11-18(16)32-20)15-9-13(21(23,24)25)6-7-14(15)22/h2-7,9,16,18H,8,10-11H2,1H3/b26-20- |
| InChIKey | WKIKTHZBFIZFFM-QOMWVZHYSA-N |
| XLogP | 4.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|