C24H27BrN2O6S2 — CID 98191531
N-[(3aS,6aR)-3-(2-bromo-4,5-diethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide (PubChem CID 98191531) has the molecular formula C24H27BrN2O6S2 and a molecular weight of 583.53 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2-bromo-4,5-diethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-3-(2-bromo-4,5-diethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98191531 |
| Molecular Formula | C24H27BrN2O6S2 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | N-[(3aS,6aR)-3-(2-bromo-4,5-diethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(Br)c(N2/C(=N/C(=O)Cc3ccccc3OC)S[C@H]3CS(=O)(=O)C[C@@H]32)cc1OCC |
| InChI | InChI=1S/C24H27BrN2O6S2/c1-4-32-20-11-16(25)17(12-21(20)33-5-2)27-18-13-35(29,30)14-22(18)34-24(27)26-23(28)10-15-8-6-7-9-19(15)31-3/h6-9,11-12,18,22H,4-5,10,13-14H2,1-3H3/b26-24-/t18-,22-/m0/s1 |
| InChIKey | RKKRWCVJRBIGPZ-VQXKQIMFSA-N |
| XLogP | 4.10 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|