C19H16BrClN2O4S2 — CID 43838832
N-[3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide (PubChem CID 43838832) has the molecular formula C19H16BrClN2O4S2 and a molecular weight of 515.84 g/mol. Its IUPAC name is N-[3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide.
| Compound Name | N-[3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 43838832 |
| Molecular Formula | C19H16BrClN2O4S2 |
| Molecular Weight | 515.84 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | N-[3-(4-bromo-2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C19H16BrClN2O4S2/c20-12-6-7-15(14(21)8-12)23-16-10-29(25,26)11-17(16)28-19(23)22-18(24)9-27-13-4-2-1-3-5-13/h1-8,16-17H,9-11H2/b22-19- |
| InChIKey | KOUWDSDWCZUXKZ-QOCHGBHMSA-N |
| XLogP | 3.78 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|