C26H23ClN2O4S2 — CID 98192397
N-[(3aR,6aS)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide (PubChem CID 98192397) has the molecular formula C26H23ClN2O4S2 and a molecular weight of 527.07 g/mol. Its IUPAC name is N-[(3aR,6aS)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(3aR,6aS)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 98192397 |
| Molecular Formula | C26H23ClN2O4S2 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N-[(3aR,6aS)-5,5-dioxo-3-(4-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23ClN2O4S2/c27-20-8-6-18(7-9-20)14-25(30)28-26-29(23-16-35(31,32)17-24(23)34-26)21-10-12-22(13-11-21)33-15-19-4-2-1-3-5-19/h1-13,23-24H,14-17H2/b28-26-/t23-,24-/m1/s1 |
| InChIKey | NIIBWMMFPMOKIQ-PCYFMKQLSA-N |
| XLogP | 4.76 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|