C19H26N2O3S2 — CID 39741303
N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide (PubChem CID 39741303) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide |
|---|---|
| PubChem CID | 39741303 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide |
| SMILES | CCCCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1C(C)C |
| InChI | InChI=1S/C19H26N2O3S2/c1-4-5-10-18(22)20-19-21(15-9-7-6-8-14(15)13(2)3)16-11-26(23,24)12-17(16)25-19/h6-9,13,16-17H,4-5,10-12H2,1-3H3/b20-19-/t16-,17-/m0/s1 |
| InChIKey | VCQYADFCGPPAJC-CMQBPOAVSA-N |
| XLogP | 3.60 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|