C20H28N2O3S2 — CID 39741366
N-[(3aS,6aS)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide (PubChem CID 39741366) has the molecular formula C20H28N2O3S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[(3aS,6aS)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide.
| Compound Name | N-[(3aS,6aS)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
|---|---|
| PubChem CID | 39741366 |
| Molecular Formula | C20H28N2O3S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(3aS,6aS)-5,5-dioxo-3-(2-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1C(C)C |
| InChI | InChI=1S/C20H28N2O3S2/c1-5-14(6-2)19(23)21-20-22(16-10-8-7-9-15(16)13(3)4)17-11-27(24,25)12-18(17)26-20/h7-10,13-14,17-18H,5-6,11-12H2,1-4H3/b21-20-/t17-,18+/m0/s1 |
| InChIKey | IVNZMIGTSDNTOQ-MYLWSRITSA-N |
| XLogP | 3.85 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|