C17H20Cl2N2O3S2 — CID 39879237
N-[(3aR,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide (PubChem CID 39879237) has the molecular formula C17H20Cl2N2O3S2 and a molecular weight of 435.40 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide.
| Compound Name | N-[(3aR,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
|---|---|
| PubChem CID | 39879237 |
| Molecular Formula | C17H20Cl2N2O3S2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-[(3aR,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O3S2/c1-3-10(4-2)16(22)20-17-21(13-6-5-11(18)7-12(13)19)14-8-26(23,24)9-15(14)25-17/h5-7,10,14-15H,3-4,8-9H2,1-2H3/b20-17-/t14-,15+/m1/s1 |
| InChIKey | YUSMIIOTSHDMMQ-GAYUIZRLSA-N |
| XLogP | 4.03 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|