C16H18Cl2N2O3S2 — CID 51860879
(2R)-N-[(3aR,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide (PubChem CID 51860879) has the molecular formula C16H18Cl2N2O3S2 and a molecular weight of 421.37 g/mol. Its IUPAC name is (2R)-N-[(3aR,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide.
| Compound Name | (2R)-N-[(3aR,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide |
|---|---|
| PubChem CID | 51860879 |
| Molecular Formula | C16H18Cl2N2O3S2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | (2R)-N-[(3aR,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O3S2/c1-3-9(2)15(21)19-16-20(12-6-10(17)4-5-11(12)18)13-7-25(22,23)8-14(13)24-16/h4-6,9,13-14H,3,7-8H2,1-2H3/b19-16-/t9-,13-,14+/m1/s1 |
| InChIKey | XREOIAYARHWCGU-FFTUSVOTSA-N |
| XLogP | 3.64 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|