C18H20ClF3N2O3S2 — CID 39879458
N-[(3aS,6aS)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide (PubChem CID 39879458) has the molecular formula C18H20ClF3N2O3S2 and a molecular weight of 468.95 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide.
| Compound Name | N-[(3aS,6aS)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
|---|---|
| PubChem CID | 39879458 |
| Molecular Formula | C18H20ClF3N2O3S2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[(3aS,6aS)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H20ClF3N2O3S2/c1-3-10(4-2)16(25)23-17-24(14-8-29(26,27)9-15(14)28-17)13-7-11(18(20,21)22)5-6-12(13)19/h5-7,10,14-15H,3-4,8-9H2,1-2H3/b23-17-/t14-,15+/m0/s1 |
| InChIKey | CNRYQCAGPNDUEL-SSTCRUARSA-N |
| XLogP | 4.40 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|