C16H18Cl2N2O3S2 — CID 39879167
N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide (PubChem CID 39879167) has the molecular formula C16H18Cl2N2O3S2 and a molecular weight of 421.37 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 39879167 |
| Molecular Formula | C16H18Cl2N2O3S2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O3S2/c1-16(2,3)14(21)19-15-20(11-5-4-9(17)6-10(11)18)12-7-25(22,23)8-13(12)24-15/h4-6,12-13H,7-8H2,1-3H3/b19-15-/t12-,13-/m0/s1 |
| InChIKey | AUOYHUBVSCASJG-VMKWEQHSSA-N |
| XLogP | 3.64 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|