C16H16Cl2N2O4S2 — CID 51551858
(2S)-N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 51551858) has the molecular formula C16H16Cl2N2O4S2 and a molecular weight of 435.35 g/mol. Its IUPAC name is (2S)-N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51551858 |
| Molecular Formula | C16H16Cl2N2O4S2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | (2S)-N-[(3aS,6aR)-3-(2,4-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | O=C(/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Cl)cc1Cl)[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H16Cl2N2O4S2/c17-9-3-4-11(10(18)6-9)20-12-7-26(22,23)8-14(12)25-16(20)19-15(21)13-2-1-5-24-13/h3-4,6,12-14H,1-2,5,7-8H2/b19-16-/t12-,13-,14-/m0/s1 |
| InChIKey | FRNHSCMVRMEJEB-ABOIIOPRSA-N |
| XLogP | 2.77 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|