C16H18N2O4S2 — CID 7552355
(2S)-N-[(3aS,6aR)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 7552355) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2S)-N-[(3aS,6aR)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(3aS,6aR)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 7552355 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2S)-N-[(3aS,6aR)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | O=C(/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H18N2O4S2/c19-15(13-7-4-8-22-13)17-16-18(11-5-2-1-3-6-11)12-9-24(20,21)10-14(12)23-16/h1-3,5-6,12-14H,4,7-10H2/b17-16-/t12-,13-,14-/m0/s1 |
| InChIKey | PJVZAXWVYKIPBD-ZWZWITGSSA-N |
| XLogP | 1.47 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|