C18H20N2O5S2 — CID 98655259
(2R)-N-[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 98655259) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R)-N-[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 98655259 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (2R)-N-[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | CC(=O)c1cccc(N2/C(=N/C(=O)[C@H]3CCCO3)S[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-11(21)12-4-2-5-13(8-12)20-14-9-27(23,24)10-16(14)26-18(20)19-17(22)15-6-3-7-25-15/h2,4-5,8,14-16H,3,6-7,9-10H2,1H3/b19-18-/t14-,15+,16+/m0/s1 |
| InChIKey | ZXMDQAFMTFVMSB-HRZXJQLMSA-N |
| XLogP | 1.67 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|