C18H22N2O6S2 — CID 4903536
N-[3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 4903536) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4903536 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | COc1ccc(N2/C(=N/C(=O)C3CCCO3)SC3CS(=O)(=O)CC32)cc1OC |
| InChI | InChI=1S/C18H22N2O6S2/c1-24-13-6-5-11(8-15(13)25-2)20-12-9-28(22,23)10-16(12)27-18(20)19-17(21)14-4-3-7-26-14/h5-6,8,12,14,16H,3-4,7,9-10H2,1-2H3/b19-18- |
| InChIKey | KOEDPPDEGUEJKK-HNENSFHCSA-N |
| XLogP | 1.48 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|