C17H19ClN2O5S2 — CID 41091666
(2S)-N-[(3aS,6aR)-3-(3-chloro-4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 41091666) has the molecular formula C17H19ClN2O5S2 and a molecular weight of 430.94 g/mol. Its IUPAC name is (2S)-N-[(3aS,6aR)-3-(3-chloro-4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(3aS,6aR)-3-(3-chloro-4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 41091666 |
| Molecular Formula | C17H19ClN2O5S2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | (2S)-N-[(3aS,6aR)-3-(3-chloro-4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | COc1ccc(N2/C(=N/C(=O)[C@@H]3CCCO3)S[C@H]3CS(=O)(=O)C[C@@H]32)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O5S2/c1-24-13-5-4-10(7-11(13)18)20-12-8-27(22,23)9-15(12)26-17(20)19-16(21)14-3-2-6-25-14/h4-5,7,12,14-15H,2-3,6,8-9H2,1H3/b19-17-/t12-,14-,15-/m0/s1 |
| InChIKey | DSHDCRRFFWBCGC-ISXLYWAISA-N |
| XLogP | 2.13 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|