C22H17Cl2N3O6 — CID 27312063
[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 27312063) has the molecular formula C22H17Cl2N3O6 and a molecular weight of 490.30 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 27312063 |
| Molecular Formula | C22H17Cl2N3O6 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C22H17Cl2N3O6/c1-10(27-20(30)12-7-14(23)15(24)8-13(12)21(27)31)22(32)33-11(2)19(29)26-9-18(28)25-16-5-3-4-6-17(16)26/h3-8,10-11H,9H2,1-2H3,(H,25,28)/t10-,11+/m0/s1 |
| InChIKey | MJYCCRITWSCDLO-WDEREUQCSA-N |
| XLogP | 2.89 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|