C14H10Cl2N2OS — CID 2732468
2-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one (PubChem CID 2732468) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2732468 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Cl)cc2Cl)N1c1ccccn1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-9-4-5-10(11(16)7-9)14-18(13(19)8-20-14)12-3-1-2-6-17-12/h1-7,14H,8H2 |
| InChIKey | LKIZFXHDGVXYHB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |