C14H9BrCl2N2OS — CID 501036
3-(6-bromo-2-pyridinyl)-2-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one (PubChem CID 501036) has the molecular formula C14H9BrCl2N2OS and a molecular weight of 404.12 g/mol. Its IUPAC name is 3-(6-bromo-2-pyridinyl)-2-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(6-bromo-2-pyridinyl)-2-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 501036 |
| Molecular Formula | C14H9BrCl2N2OS |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 3-(6-bromo-2-pyridinyl)-2-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2c(Cl)cccc2Cl)N1c1cccc(Br)n1 |
| InChI | InChI=1S/C14H9BrCl2N2OS/c15-10-5-2-6-11(18-10)19-12(20)7-21-14(19)13-8(16)3-1-4-9(13)17/h1-6,14H,7H2 |
| InChIKey | SFMQMMHUFLKDAG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|