C17H14O4 — CID 2732543
2-hydroxy-2-(2-hydroxy-3,5-dimethylphenyl)indene-1,3-dione (PubChem CID 2732543) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-hydroxy-2-(2-hydroxy-3,5-dimethylphenyl)indene-1,3-dione.
| Compound Name | 2-hydroxy-2-(2-hydroxy-3,5-dimethylphenyl)indene-1,3-dione |
|---|---|
| PubChem CID | 2732543 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-hydroxy-2-(2-hydroxy-3,5-dimethylphenyl)indene-1,3-dione |
| SMILES | Cc1cc(C)c(O)c(C2(O)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C17H14O4/c1-9-7-10(2)14(18)13(8-9)17(21)15(19)11-5-3-4-6-12(11)16(17)20/h3-8,18,21H,1-2H3 |
| InChIKey | JPWNAWMYTQWNBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|