C22H16Cl2N2OS — CID 27331968
(2R)-N,4-bis(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxamide (PubChem CID 27331968) has the molecular formula C22H16Cl2N2OS and a molecular weight of 427.36 g/mol. Its IUPAC name is (2R)-N,4-bis(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxamide.
| Compound Name | (2R)-N,4-bis(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxamide |
|---|---|
| PubChem CID | 27331968 |
| Molecular Formula | C22H16Cl2N2OS |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (2R)-N,4-bis(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@H]1CC(c2ccc(Cl)cc2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C22H16Cl2N2OS/c23-15-7-5-14(6-8-15)19-13-21(28-20-4-2-1-3-18(20)26-19)22(27)25-17-11-9-16(24)10-12-17/h1-12,21H,13H2,(H,25,27)/t21-/m1/s1 |
| InChIKey | XTPHKPKSMOMRRV-OAQYLSRUSA-N |
| XLogP | 6.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |