About tetrabutylazanium;trifluoromethanesulfonate
tetrabutylazanium;trifluoromethanesulfonate (PubChem CID 2733306) has the molecular formula C17H36F3NO3S
and a molecular weight of 391.54 g/mol. Its IUPAC name is tetrabutylazanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | tetrabutylazanium;trifluoromethanesulfonate |
| PubChem CID | 2733306 |
| Molecular Formula | C17H36F3NO3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | tetrabutylazanium;trifluoromethanesulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YNJQKNVVBBIPBA-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;trifluoromethanesulfonate?
The IUPAC name of tetrabutylazanium;trifluoromethanesulfonate (CID 2733306) is tetrabutylazanium;trifluoromethanesulfonate.
What is the SMILES notation for tetrabutylazanium;trifluoromethanesulfonate?
The canonical SMILES for tetrabutylazanium;trifluoromethanesulfonate is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of tetrabutylazanium;trifluoromethanesulfonate?
The InChIKey is YNJQKNVVBBIPBA-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of tetrabutylazanium;trifluoromethanesulfonate?
tetrabutylazanium;trifluoromethanesulfonate has a molecular weight of 391.54 g/mol, XLogP of 5.05, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;trifluoromethanesulfonate is sourced from PubChem (CID 2733306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).