About methyl 3-isocyanatobenzoate
methyl 3-isocyanatobenzoate (PubChem CID 2733366) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl 3-isocyanatobenzoate.
Molecular Properties
| Compound Name | methyl 3-isocyanatobenzoate |
| PubChem CID | 2733366 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | methyl 3-isocyanatobenzoate |
| SMILES | COC(=O)c1cccc(N=C=O)c1 |
| InChI | InChI=1S/C9H7NO3/c1-13-9(12)7-3-2-4-8(5-7)10-6-11/h2-5H,1H3 |
| InChIKey | WBGWGERFPSYHDT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-isocyanatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-isocyanatobenzoate?
The IUPAC name of methyl 3-isocyanatobenzoate (CID 2733366) is methyl 3-isocyanatobenzoate.
What is the SMILES notation for methyl 3-isocyanatobenzoate?
The canonical SMILES for methyl 3-isocyanatobenzoate is COC(=O)c1cccc(N=C=O)c1.
What is the InChIKey of methyl 3-isocyanatobenzoate?
The InChIKey is WBGWGERFPSYHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c1-13-9(12)7-3-2-4-8(5-7)10-6-11/h2-5H,1H3.
What are the key properties of methyl 3-isocyanatobenzoate?
methyl 3-isocyanatobenzoate has a molecular weight of 177.16 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-isocyanatobenzoate is sourced from PubChem (CID 2733366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).