C7H7Cl2N3O — CID 2735315
4-amino-3,5-dichloro-N'-hydroxybenzenecarboximidamide (PubChem CID 2735315) has the molecular formula C7H7Cl2N3O and a molecular weight of 220.06 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-amino-3,5-dichloro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 2735315 |
| Molecular Formula | C7H7Cl2N3O |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 4-amino-3,5-dichloro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C7H7Cl2N3O/c8-4-1-3(7(11)12-13)2-5(9)6(4)10/h1-2,13H,10H2,(H2,11,12) |
| InChIKey | WBOBDNOWHZRGDC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|