C9H10F2N2O — CID 91375435
3,5-bis(fluoromethyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 91375435) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 3,5-bis(fluoromethyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3,5-bis(fluoromethyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91375435 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3,5-bis(fluoromethyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(CF)cc(CF)c1 |
| InChI | InChI=1S/C9H10F2N2O/c10-4-6-1-7(5-11)3-8(2-6)9(12)13-14/h1-3,14H,4-5H2,(H2,12,13) |
| InChIKey | QFZUQSVNEUJDIS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|