C11H8ClNO2 — CID 27361
1-(4-chlorophenyl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 27361) has the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 27361 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 1-(4-chlorophenyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1NC(=O)C2(c3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C11H8ClNO2/c12-7-3-1-6(2-4-7)11-5-8(11)9(14)13-10(11)15/h1-4,8H,5H2,(H,13,14,15) |
| InChIKey | YYGANUVABKDFDW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|