C17H20N6O3S — CID 27370851
2-[3,7-dimethyl-1-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]sulfanylacetohydrazide (PubChem CID 27370851) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[3,7-dimethyl-1-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]sulfanylacetohydrazide.
| Compound Name | 2-[3,7-dimethyl-1-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]sulfanylacetohydrazide |
|---|---|
| PubChem CID | 27370851 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[3,7-dimethyl-1-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]sulfanylacetohydrazide |
| SMILES | Cc1ccc(Cn2c(=O)c3c(nc(SCC(=O)NN)n3C)n(C)c2=O)cc1 |
| InChI | InChI=1S/C17H20N6O3S/c1-10-4-6-11(7-5-10)8-23-15(25)13-14(22(3)17(23)26)19-16(21(13)2)27-9-12(24)20-18/h4-7H,8-9,18H2,1-3H3,(H,20,24) |
| InChIKey | USKLWOUERIJRPX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|