C15H18N4O3S3 — CID 27372796
2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-cyclopentylacetamide (PubChem CID 27372796) has the molecular formula C15H18N4O3S3 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-cyclopentylacetamide.
| Compound Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 27372796 |
| Molecular Formula | C15H18N4O3S3 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-cyclopentylacetamide |
| SMILES | Nc1nc(SCC(=O)NC2CCCC2)ncc1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H18N4O3S3/c16-14-11(25(21,22)13-6-3-7-23-13)8-17-15(19-14)24-9-12(20)18-10-4-1-2-5-10/h3,6-8,10H,1-2,4-5,9H2,(H,18,20)(H2,16,17,19) |
| InChIKey | WNBRZVYMNMNKKL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |