C15H18N4O4S3 — CID 50769858
2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 50769858) has the molecular formula C15H18N4O4S3 and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 50769858 |
| Molecular Formula | C15H18N4O4S3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Nc1nc(SCC(=O)NCC2CCCO2)ncc1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H18N4O4S3/c16-14-11(26(21,22)13-4-2-6-24-13)8-18-15(19-14)25-9-12(20)17-7-10-3-1-5-23-10/h2,4,6,8,10H,1,3,5,7,9H2,(H,17,20)(H2,16,18,19) |
| InChIKey | LEWIWIDSIROSNP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |