C28H29FN4O3 — CID 27374706
N-[2-(cyclohexen-1-yl)ethyl]-2-[8-fluoro-3-[(4-methoxyphenyl)methyl]-4-oxopyrimido[5,4-b]indol-5-yl]acetamide (PubChem CID 27374706) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[8-fluoro-3-[(4-methoxyphenyl)methyl]-4-oxopyrimido[5,4-b]indol-5-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[8-fluoro-3-[(4-methoxyphenyl)methyl]-4-oxopyrimido[5,4-b]indol-5-yl]acetamide |
|---|---|
| PubChem CID | 27374706 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[8-fluoro-3-[(4-methoxyphenyl)methyl]-4-oxopyrimido[5,4-b]indol-5-yl]acetamide |
| SMILES | COc1ccc(Cn2cnc3c4cc(F)ccc4n(CC(=O)NCCC4=CCCCC4)c3c2=O)cc1 |
| InChI | InChI=1S/C28H29FN4O3/c1-36-22-10-7-20(8-11-22)16-32-18-31-26-23-15-21(29)9-12-24(23)33(27(26)28(32)35)17-25(34)30-14-13-19-5-3-2-4-6-19/h5,7-12,15,18H,2-4,6,13-14,16-17H2,1H3,(H,30,34) |
| InChIKey | DZONBRSHZKLUAP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|