C14H17ClN2O2 — CID 2738286
1-azabicyclo[2.2.2]octan-3-yl N-(2-chlorophenyl)carbamate (PubChem CID 2738286) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-(2-chlorophenyl)carbamate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-(2-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 2738286 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-(2-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1Cl)OC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H17ClN2O2/c15-11-3-1-2-4-12(11)16-14(18)19-13-9-17-7-5-10(13)6-8-17/h1-4,10,13H,5-9H2,(H,16,18) |
| InChIKey | LGTXTMDJPFXCMX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |