C14H18N2O2 — CID 684225
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-phenylcarbamate (PubChem CID 684225) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-phenylcarbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 684225 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C14H18N2O2/c17-14(15-12-4-2-1-3-5-12)18-13-10-16-8-6-11(13)7-9-16/h1-5,11,13H,6-10H2,(H,15,17)/t13-/m0/s1 |
| InChIKey | JEPJAGMRBZWMCT-ZDUSSCGKSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |