C20H21FN2O2 — CID 155157200
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate (PubChem CID 155157200) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 155157200 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1-c1ccccc1)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C20H21FN2O2/c21-16-6-7-18(17(12-16)14-4-2-1-3-5-14)22-20(24)25-19-13-23-10-8-15(19)9-11-23/h1-7,12,15,19H,8-11,13H2,(H,22,24)/t19-/m0/s1 |
| InChIKey | LATYFBCANWEEBS-IBGZPJMESA-N |
| XLogP | 4.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |