C30H35BrN2O2 — CID 10208896
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate bromide (PubChem CID 10208896) has the molecular formula C30H35BrN2O2 and a molecular weight of 535.53 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate bromide.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate bromide |
|---|---|
| PubChem CID | 10208896 |
| Molecular Formula | C30H35BrN2O2 |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate bromide |
| SMILES | O=C(O[C@H]1C[N+]2(CCCc3ccccc3)CCC1CC2)N(Cc1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C30H35N2O2.BrH/c33-30(31(28-16-8-3-9-17-28)23-26-13-6-2-7-14-26)34-29-24-32(21-18-27(29)19-22-32)20-10-15-25-11-4-1-5-12-25;/h1-9,11-14,16-17,27,29H,10,15,18-24H2;1H/q+1;/p-1/t27?,29-,32?;/m0./s1 |
| InChIKey | PNWQOMABRMWDMF-LVKSKBLHSA-M |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|