C17H24N2O3 — CID 2738329
2-[1-[2-[(4-ethyl-2-pyridinyl)amino]-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 2738329) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[1-[2-[(4-ethyl-2-pyridinyl)amino]-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-[(4-ethyl-2-pyridinyl)amino]-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 2738329 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[1-[2-[(4-ethyl-2-pyridinyl)amino]-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | CCc1ccnc(NC(=O)CC2(CC(=O)O)CCCCC2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-2-13-6-9-18-14(10-13)19-15(20)11-17(12-16(21)22)7-4-3-5-8-17/h6,9-10H,2-5,7-8,11-12H2,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | FWJWUOOIZFFXQC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |