C23H25N3O3S — CID 2738472
2,2-dimethyl-N,N-bis(pyridin-2-ylmethyl)-3,4-dihydrochromene-6-sulfonamide (PubChem CID 2738472) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2,2-dimethyl-N,N-bis(pyridin-2-ylmethyl)-3,4-dihydrochromene-6-sulfonamide.
| Compound Name | 2,2-dimethyl-N,N-bis(pyridin-2-ylmethyl)-3,4-dihydrochromene-6-sulfonamide |
|---|---|
| PubChem CID | 2738472 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2,2-dimethyl-N,N-bis(pyridin-2-ylmethyl)-3,4-dihydrochromene-6-sulfonamide |
| SMILES | CC1(C)CCc2cc(S(=O)(=O)N(Cc3ccccn3)Cc3ccccn3)ccc2O1 |
| InChI | InChI=1S/C23H25N3O3S/c1-23(2)12-11-18-15-21(9-10-22(18)29-23)30(27,28)26(16-19-7-3-5-13-24-19)17-20-8-4-6-14-25-20/h3-10,13-15H,11-12,16-17H2,1-2H3 |
| InChIKey | XKSKAHAZZLJWMM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |