C16H14F2N2O3 — CID 2739042
[3-[(2,6-difluorobenzoyl)amino]phenyl] N,N-dimethylcarbamate (PubChem CID 2739042) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is [3-[(2,6-difluorobenzoyl)amino]phenyl] N,N-dimethylcarbamate.
| Compound Name | [3-[(2,6-difluorobenzoyl)amino]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 2739042 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [3-[(2,6-difluorobenzoyl)amino]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc(NC(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C16H14F2N2O3/c1-20(2)16(22)23-11-6-3-5-10(9-11)19-15(21)14-12(17)7-4-8-13(14)18/h3-9H,1-2H3,(H,19,21) |
| InChIKey | KCOIHBAAJSXSRX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |