C17H7F7O3 — CID 2739942
[3-(trifluoromethyl)phenyl] 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 2739942) has the molecular formula C17H7F7O3 and a molecular weight of 392.23 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl] 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2739942 |
| Molecular Formula | C17H7F7O3 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1C(=O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H7F7O3/c1-6-9(10-11(18)12(19)13(20)14(21)15(10)26-6)16(25)27-8-4-2-3-7(5-8)17(22,23)24/h2-5H,1H3 |
| InChIKey | QPSJUSIRZROWQE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|