C17H12F3NOS3 — CID 2740339
3,3-bis(methylsulfanyl)-2-[4-phenyl-5-(trifluoromethyl)thiophene-2-carbonyl]prop-2-enenitrile (PubChem CID 2740339) has the molecular formula C17H12F3NOS3 and a molecular weight of 399.48 g/mol. Its IUPAC name is 3,3-bis(methylsulfanyl)-2-[4-phenyl-5-(trifluoromethyl)thiophene-2-carbonyl]prop-2-enenitrile.
| Compound Name | 3,3-bis(methylsulfanyl)-2-[4-phenyl-5-(trifluoromethyl)thiophene-2-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2740339 |
| Molecular Formula | C17H12F3NOS3 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 3,3-bis(methylsulfanyl)-2-[4-phenyl-5-(trifluoromethyl)thiophene-2-carbonyl]prop-2-enenitrile |
| SMILES | CSC(SC)=C(C#N)C(=O)c1cc(-c2ccccc2)c(C(F)(F)F)s1 |
| InChI | InChI=1S/C17H12F3NOS3/c1-23-16(24-2)12(9-21)14(22)13-8-11(10-6-4-3-5-7-10)15(25-13)17(18,19)20/h3-8H,1-2H3 |
| InChIKey | NJNQYYWWOHSWRA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|