C21H17F3O3 — CID 2740455
ethyl 5-oxo-6-[[3-(trifluoromethyl)phenyl]methylidene]-7,8-dihydronaphthalene-2-carboxylate (PubChem CID 2740455) has the molecular formula C21H17F3O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is ethyl 5-oxo-6-[[3-(trifluoromethyl)phenyl]methylidene]-7,8-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl 5-oxo-6-[[3-(trifluoromethyl)phenyl]methylidene]-7,8-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2740455 |
| Molecular Formula | C21H17F3O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 5-oxo-6-[[3-(trifluoromethyl)phenyl]methylidene]-7,8-dihydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)CCC(=Cc1cccc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C21H17F3O3/c1-2-27-20(26)16-8-9-18-14(12-16)6-7-15(19(18)25)10-13-4-3-5-17(11-13)21(22,23)24/h3-5,8-12H,2,6-7H2,1H3 |
| InChIKey | PMRYXWRYEITPLY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|