C19H14Cl2F3N3O4 — CID 2740609
2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 2740609) has the molecular formula C19H14Cl2F3N3O4 and a molecular weight of 476.24 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 2740609 |
| Molecular Formula | C19H14Cl2F3N3O4 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)OCCOc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C19H14Cl2F3N3O4/c1-10-16(17(27-31-10)15-12(20)3-2-4-13(15)21)26-18(28)30-8-7-29-14-9-11(5-6-25-14)19(22,23)24/h2-6,9H,7-8H2,1H3,(H,26,28) |
| InChIKey | HPXQKKHHPNOSFU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|