C10H10FN3S2 — CID 2741205
[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 2741205) has the molecular formula C10H10FN3S2 and a molecular weight of 255.34 g/mol. Its IUPAC name is [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
| Compound Name | [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 2741205 |
| Molecular Formula | C10H10FN3S2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | NC(=S)NN=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FN3S2/c11-6-1-2-9-7(5-6)8(3-4-16-9)13-14-10(12)15/h1-2,5H,3-4H2,(H3,12,14,15) |
| InChIKey | TYYKJAASQGXIHN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|