C25H21ClN2O — CID 2742338
5-(4-chlorophenyl)-2-methyl-N-(2-methylphenyl)-1-phenylpyrrole-3-carboxamide (PubChem CID 2742338) has the molecular formula C25H21ClN2O and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-N-(2-methylphenyl)-1-phenylpyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-N-(2-methylphenyl)-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 2742338 |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-N-(2-methylphenyl)-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C25H21ClN2O/c1-17-8-6-7-11-23(17)27-25(29)22-16-24(19-12-14-20(26)15-13-19)28(18(22)2)21-9-4-3-5-10-21/h3-16H,1-2H3,(H,27,29) |
| InChIKey | KHKVFZLYXWMLNU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|